Products 110510-78-6
CAS 110510-78-6 appears in our catalog under these names: n-Decyl-d21 Alcohol, 98 atom % D, min 98% Chemical Purity, 1–Decanol–d21, 1-Decanol-d21. Offered by: CDN, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 10mg, 500mg, 250mg, 1 mg.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosadeuteriodecan-1-ol (CAS 110510-78-6) is a chemical compound with the molecular formula C10H22O and a molecular weight of 179.41 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosadeuteriodecan-1-ol. InChIKey: MWKFXSUHUHTGQN-SLBGAMDCSA-N.
| Molecular formula | C10H22O |
|---|---|
| Molecular weight | 179.41 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosadeuteriodecan-1-ol |
| InChIKey | MWKFXSUHUHTGQN-SLBGAMDCSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)