CAS 1105189-56-7 is the registry number for 5-amino-1-(3,4-dimethylphenyl)-1,5-dihydro-4H-pyrazolo(3,4-d)pyrimidin-4-one, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
5-amino-1-(3,4-dimethylphenyl)pyrazolo[5,4-d]pyrimidin-4-one (CAS 1105189-56-7) is a chemical compound with the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. IUPAC name: 5-amino-1-(3,4-dimethylphenyl)pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: OSJVEYMJBSQAMC-UHFFFAOYSA-N.
| Molecular formula | C13H13N5O |
|---|---|
| Molecular weight | 255.28 g/mol |
| IUPAC name | 5-amino-1-(3,4-dimethylphenyl)pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | OSJVEYMJBSQAMC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C3=C(C=N2)C(=O)N(C=N3)N)C |
Computed by PubChem (NCBI)