CAS 1105190-54-2 is the registry number for 5-(4-Methoxyphenyl)-1-(p-tolyl)-1H-imidazole-2-thiol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-methoxyphenyl)-3-(4-methylphenyl)-1H-imidazole-2-thione (CAS 1105190-54-2) is a chemical compound with the molecular formula C17H16N2OS and a molecular weight of 296.4 g/mol. IUPAC name: 4-(4-methoxyphenyl)-3-(4-methylphenyl)-1H-imidazole-2-thione. InChIKey: BTWDJKORWDAOGZ-UHFFFAOYSA-N.
| Molecular formula | C17H16N2OS |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-3-(4-methylphenyl)-1H-imidazole-2-thione |
| InChIKey | BTWDJKORWDAOGZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=CNC2=S)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)