CAS 1105196-44-8 appears in our catalog under these names: 1-tert-Butyl-4-methyl-1,6-dihydro-7h-pyrazolo[3,4-d]pyridazin-7-one, 95%, 1-(tert-Butyl)-4-methyl-1,6-dihydro-7H-pyrazolo(3,4-d)pyridazin-7-one, 98%, 1-tert-Butyl-4-methyl-1H,6H,7H-pyrazolo(3,4-d)pyridazin-7-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 2,5g.
1-tert-butyl-4-methyl-6H-pyrazolo[4,5-d]pyridazin-7-one (CAS 1105196-44-8) is a chemical compound with the molecular formula C10H14N4O and a molecular weight of 206.24 g/mol. IUPAC name: 1-tert-butyl-4-methyl-6H-pyrazolo[4,5-d]pyridazin-7-one. InChIKey: BZFQZARONURLLI-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 1-tert-butyl-4-methyl-6H-pyrazolo[4,5-d]pyridazin-7-one |
| InChIKey | BZFQZARONURLLI-UHFFFAOYSA-N |
| SMILES | CC1=NNC(=O)C2=C1C=NN2C(C)(C)C |
Computed by PubChem (NCBI)