Products 11054-42-5
CAS 11054-42-5 is the registry number for Pterygospermin. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,8-dibenzyl-3,10-dioxa-1,8-diazadispiro[3.2.37.24]dodeca-5,11-diene-2,9-dithione (CAS 11054-42-5) is a chemical compound with the molecular formula C22H18N2O2S2 and a molecular weight of 406.5 g/mol. IUPAC name: 1,8-dibenzyl-3,10-dioxa-1,8-diazadispiro[3.2.37.24]dodeca-5,11-diene-2,9-dithione. InChIKey: OGWNPNIRZURLGD-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O2S2 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | 1,8-dibenzyl-3,10-dioxa-1,8-diazadispiro[3.2.37.24]dodeca-5,11-diene-2,9-dithione |
| InChIKey | OGWNPNIRZURLGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=S)OC23C=CC4(C=C3)N(C(=S)O4)CC5=CC=CC=C5 |
Computed by PubChem (NCBI)