CAS 110548-07-7 appears in our catalog under these names: Levofloxacin Impurity 8, Levofloxacin Impurity 5, Levofloxacin Impurity 19, (3R)-9,10-Difluoro-2,3-dihydro-3-methyl-7-oxo-7H-pyrido(1,2,3-de)-1,4-benzoxazine-6-carboxylic Acid (>85%), (R)-Ofloxacin Carboxylic Acid (Dextrofloxacin Difluoro Impurity). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 250mg.
(2R)-6,7-difluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid (CAS 110548-07-7) is a chemical compound with the molecular formula C13H9F2NO4 and a molecular weight of 281.21 g/mol. IUPAC name: (2R)-6,7-difluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid. InChIKey: NVKWWNNJFKZNJO-RXMQYKEDSA-N.
| Molecular formula | C13H9F2NO4 |
|---|---|
| Molecular weight | 281.21 g/mol |
| IUPAC name | (2R)-6,7-difluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| InChIKey | NVKWWNNJFKZNJO-RXMQYKEDSA-N |
| SMILES | C[C@@H]1COC2=C3N1C=C(C(=O)C3=CC(=C2F)F)C(=O)O |
Computed by PubChem (NCBI)