CAS 1105663-57-7 is the registry number for (1R,5S)-Bicyclo(3.2.0)heptane-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S,5R)-bicyclo[3.2.0]heptane-2,4-dione (CAS 1105663-57-7) is a chemical compound with the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. IUPAC name: (1S,5R)-bicyclo[3.2.0]heptane-2,4-dione. InChIKey: RUSUJAKXQJRXRZ-SYDPRGILSA-N.
| Molecular formula | C7H8O2 |
|---|---|
| Molecular weight | 124.14 g/mol |
| IUPAC name | (1S,5R)-bicyclo[3.2.0]heptane-2,4-dione |
| InChIKey | RUSUJAKXQJRXRZ-SYDPRGILSA-N |
| SMILES | C1C[C@H]2[C@@H]1C(=O)CC2=O |
Computed by PubChem (NCBI)