CAS 1105741-26-1 is the registry number for rel-(3R,4R)-Methyl 4-aminotetrahydro-2H-pyran-3-carboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 250mg.
Methyl (3S,4S)-4-aminooxane-3-carboxylate (CAS 1105741-26-1) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. IUPAC name: methyl (3S,4S)-4-aminooxane-3-carboxylate. InChIKey: PLVOQXPMPPTFRW-RITPCOANSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | methyl (3S,4S)-4-aminooxane-3-carboxylate |
| InChIKey | PLVOQXPMPPTFRW-RITPCOANSA-N |
| SMILES | COC(=O)[C@@H]1COCC[C@@H]1N |
Computed by PubChem (NCBI)