Products 110599-67-2
CAS 110599-67-2 appears in our catalog under these names: 2-Methyl 3,4-dihydro-1,2(1H)-isoquinolinedicarboxylate, 98%, 2-(Methoxycarbonyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methoxycarbonyl-3,4-dihydro-1H-isoquinoline-1-carboxylate (CAS 110599-67-2) is a chemical compound with the molecular formula C12H12NO4- and a molecular weight of 234.23 g/mol. IUPAC name: 2-methoxycarbonyl-3,4-dihydro-1H-isoquinoline-1-carboxylate. InChIKey: KZFWIMQCWWZZAQ-UHFFFAOYSA-M.
| Molecular formula | C12H12NO4- |
|---|---|
| Molecular weight | 234.23 g/mol |
| IUPAC name | 2-methoxycarbonyl-3,4-dihydro-1H-isoquinoline-1-carboxylate |
| InChIKey | KZFWIMQCWWZZAQ-UHFFFAOYSA-M |
| SMILES | COC(=O)N1CCC2=CC=CC=C2C1C(=O)[O-] |
Computed by PubChem (NCBI)