CAS 110611-21-7 is the registry number for (1R)-1-(4-Chlorophenyl)-1-propanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(4-chlorophenyl)propan-1-ol (CAS 110611-21-7) is a chemical compound with the molecular formula C9H11ClO and a molecular weight of 170.63 g/mol. IUPAC name: (1R)-1-(4-chlorophenyl)propan-1-ol. InChIKey: TXAWBKBMGZKBNN-SECBINFHSA-N.
| Molecular formula | C9H11ClO |
|---|---|
| Molecular weight | 170.63 g/mol |
| IUPAC name | (1R)-1-(4-chlorophenyl)propan-1-ol |
| InChIKey | TXAWBKBMGZKBNN-SECBINFHSA-N |
| SMILES | CC[C@H](C1=CC=C(C=C1)Cl)O |
Computed by PubChem (NCBI)