CAS 110660-78-1 is the registry number for (2S)-2,3-Dihydro-1H-indole-2-carboxamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(2S)-2,3-dihydro-1H-indole-2-carboxamide (CAS 110660-78-1) is a chemical compound with the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. IUPAC name: (2S)-2,3-dihydro-1H-indole-2-carboxamide. InChIKey: ATEDHUGCKSZDCP-QMMMGPOBSA-N.
| Molecular formula | C9H10N2O |
|---|---|
| Molecular weight | 162.19 g/mol |
| IUPAC name | (2S)-2,3-dihydro-1H-indole-2-carboxamide |
| InChIKey | ATEDHUGCKSZDCP-QMMMGPOBSA-N |
| SMILES | C1[C@H](NC2=CC=CC=C21)C(=O)N |
Computed by PubChem (NCBI)