Products 1106941-19-8
CAS 1106941-19-8 is the registry number for 17β-HSD5 inhibitor 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 3-[2-pyridin-4-yl-5-(trifluoromethyl)benzimidazol-1-yl]benzoate (CAS 1106941-19-8) is a chemical compound with the molecular formula C22H16F3N3O2 and a molecular weight of 411.4 g/mol. IUPAC name: ethyl 3-[2-pyridin-4-yl-5-(trifluoromethyl)benzimidazol-1-yl]benzoate. InChIKey: HXKXNLITHYLEMP-UHFFFAOYSA-N.
| Molecular formula | C22H16F3N3O2 |
|---|---|
| Molecular weight | 411.4 g/mol |
| IUPAC name | ethyl 3-[2-pyridin-4-yl-5-(trifluoromethyl)benzimidazol-1-yl]benzoate |
| InChIKey | HXKXNLITHYLEMP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)N2C3=C(C=C(C=C3)C(F)(F)F)N=C2C4=CC=NC=C4 |
Computed by PubChem (NCBI)