CAS 11076-17-8 is the registry number for Sordarin. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
Sordarin is an antifungal metabolite of Sordaria araneosa that inhibits protein synthesis. It has a tetracyclic diterpene glycoside structure. It has a role as an antifungal agent and a protein synthesis inhibitor. It is a glycoside, a tetracyclic diterpenoid and a monosaccharide derivative.
Source: ChEBI
| Molecular formula | C27H40O8 |
|---|---|
| Molecular weight | 492.6 g/mol |
| IUPAC name | (1R,2S,4R,5R,8R,9S,11R)-2-[[(2R,3S,4S,5S,6R)-3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl]oxymethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
| InChIKey | OGGVRVMISBQNMQ-YPBSLCSMSA-N |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H]1C[C@@]3([C@@H]4C[C@]2([C@]3(C(=C4)C(C)C)C(=O)O)C=O)CO[C@H]5[C@H]([C@@H]([C@@H]([C@H](O5)C)OC)O)O |
Computed by PubChem (NCBI)