Products 1107650-54-3
CAS 1107650-54-3 is the registry number for Dimethyl Diglycolate-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 1g, 100 mg, 1 g.
Methyl 2,2-dideuterio-2-(1,1-dideuterio-2-methoxy-2-oxoethoxy)acetate (CAS 1107650-54-3) is a chemical compound with the molecular formula C6H10O5 and a molecular weight of 166.16 g/mol. IUPAC name: methyl 2,2-dideuterio-2-(1,1-dideuterio-2-methoxy-2-oxoethoxy)acetate. InChIKey: KUCRTUQUAYLJDC-KHORGVISSA-N.
| Molecular formula | C6H10O5 |
|---|---|
| Molecular weight | 166.16 g/mol |
| IUPAC name | methyl 2,2-dideuterio-2-(1,1-dideuterio-2-methoxy-2-oxoethoxy)acetate |
| InChIKey | KUCRTUQUAYLJDC-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C(=O)OC)OC([2H])([2H])C(=O)OC |
Computed by PubChem (NCBI)