Products 1108187-27-4

CAS 1108187-27-4 is the registry number for 1,3-Diethyl 2-((4-fluorophenyl)methyl)-2-methylpropanedioate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Diethyl 2-[(4-fluorophenyl)methyl]-2-methylpropanedioate (CAS 1108187-27-4) is a chemical compound with the molecular formula C15H19FO4 and a molecular weight of 282.31 g/mol. IUPAC name: diethyl 2-[(4-fluorophenyl)methyl]-2-methylpropanedioate. InChIKey: YQTMXGIDBQDJOM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19FO4
Molecular weight282.31 g/mol
IUPAC namediethyl 2-[(4-fluorophenyl)methyl]-2-methylpropanedioate
InChIKeyYQTMXGIDBQDJOM-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)(CC1=CC=C(C=C1)F)C(=O)OCC

Computed by PubChem (NCBI)