CAS 110861-66-0 appears in our catalog under these names: Calcium 4-cyclohexylbutanoate, 98%, Calcium cyclohexanebutyrate. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g.
Calcium bis(4-cyclohexylbutanoate) (CAS 110861-66-0) is a chemical compound with the molecular formula C20H34CaO4 and a molecular weight of 378.6 g/mol. IUPAC name: calcium bis(4-cyclohexylbutanoate). InChIKey: HJZOVZBKGRJCRX-UHFFFAOYSA-L.
| Molecular formula | C20H34CaO4 |
|---|---|
| Molecular weight | 378.6 g/mol |
| IUPAC name | calcium bis(4-cyclohexylbutanoate) |
| InChIKey | HJZOVZBKGRJCRX-UHFFFAOYSA-L |
| SMILES | C1CCC(CC1)CCCC(=O)[O-].C1CCC(CC1)CCCC(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)