Products 1108712-48-6

CAS 1108712-48-6 is the registry number for 5-(Methoxymethyl)-3-methylisoxazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(methoxymethyl)-3-methyl-1,2-oxazole-4-carboxylic acid (CAS 1108712-48-6) is a chemical compound with the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. IUPAC name: 5-(methoxymethyl)-3-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: OFYWPMZISFZALQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO4
Molecular weight171.15 g/mol
IUPAC name5-(methoxymethyl)-3-methyl-1,2-oxazole-4-carboxylic acid
InChIKeyOFYWPMZISFZALQ-UHFFFAOYSA-N
SMILESCC1=NOC(=C1C(=O)O)COC

Computed by PubChem (NCBI)