CAS 110916-44-4 is the registry number for (3,5-Dimethyladamantan-1-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3,5-dimethyl-1-adamantyl)methanamine (CAS 110916-44-4) is a chemical compound with the molecular formula C13H23N and a molecular weight of 193.33 g/mol. IUPAC name: (3,5-dimethyl-1-adamantyl)methanamine. InChIKey: GPYYBGAAAREIRT-UHFFFAOYSA-N.
| Molecular formula | C13H23N |
|---|---|
| Molecular weight | 193.33 g/mol |
| IUPAC name | (3,5-dimethyl-1-adamantyl)methanamine |
| InChIKey | GPYYBGAAAREIRT-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)(CC(C3)(C2)CN)C |
Computed by PubChem (NCBI)