CAS 110993-57-2 is the registry number for Ferulic Acid Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate (CAS 110993-57-2) is a chemical compound with the molecular formula C10H9NaO4 and a molecular weight of 216.17 g/mol. IUPAC name: sodium (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate. InChIKey: DSGXMEGLIMXDNB-WGCWOXMQSA-M.
| Molecular formula | C10H9NaO4 |
|---|---|
| Molecular weight | 216.17 g/mol |
| IUPAC name | sodium (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| InChIKey | DSGXMEGLIMXDNB-WGCWOXMQSA-M |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)