CAS 111031-17-5 appears in our catalog under these names: Clethodim Sulfone, Clethodim-sulfone. Offered by: TRC, Biosynth, HPC Standards, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 1x5mg, 10 mg, 5 mg.
2-[(E)-N-[(E)-3-chloroprop-2-enoxy]-C-ethylcarbonimidoyl]-5-(2-ethylsulfonylpropyl)-3-hydroxycyclohex-2-en-1-one (CAS 111031-17-5) is a chemical compound with the molecular formula C17H26ClNO5S and a molecular weight of 391.9 g/mol. IUPAC name: 2-[(E)-N-[(E)-3-chloroprop-2-enoxy]-C-ethylcarbonimidoyl]-5-(2-ethylsulfonylpropyl)-3-hydroxycyclohex-2-en-1-one. InChIKey: GLOKEOJMCXNRJB-KUZBFYBWSA-N.
| Molecular formula | C17H26ClNO5S |
|---|---|
| Molecular weight | 391.9 g/mol |
| IUPAC name | 2-[(E)-N-[(E)-3-chloroprop-2-enoxy]-C-ethylcarbonimidoyl]-5-(2-ethylsulfonylpropyl)-3-hydroxycyclohex-2-en-1-one |
| InChIKey | GLOKEOJMCXNRJB-KUZBFYBWSA-N |
| SMILES | CC/C(=N\OC/C=C/Cl)/C1=C(CC(CC1=O)CC(C)S(=O)(=O)CC)O |
Computed by PubChem (NCBI)