Products 111044-84-9
CAS 111044-84-9 is the registry number for 2-(2'-Hydroxy-4'-methylphenyl)propionic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2-hydroxy-4-methylphenyl)propanoic acid (CAS 111044-84-9) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-(2-hydroxy-4-methylphenyl)propanoic acid. InChIKey: OFFRVASYEAWIFS-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-(2-hydroxy-4-methylphenyl)propanoic acid |
| InChIKey | OFFRVASYEAWIFS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(C)C(=O)O)O |
Computed by PubChem (NCBI)