CAS 111057-34-2 appears in our catalog under these names: Alpha-d-thiomannose sodium salt, 95%, alpha-D-Thiomannose Sodium Salt, α-D-Thiomannose sodium. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 2g, 10g, 5g, 1g, 100mg, 50mg, 250mg, 1000mg.
Sodium (2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-thiolate (CAS 111057-34-2) is a chemical compound with the molecular formula C6H11NaO5S and a molecular weight of 218.21 g/mol. IUPAC name: sodium (2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-thiolate. InChIKey: VKPBZIVFRYLHPT-GDTYSWHPSA-M.
| Molecular formula | C6H11NaO5S |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | sodium (2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-thiolate |
| InChIKey | VKPBZIVFRYLHPT-GDTYSWHPSA-M |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)[S-])O)O)O)O.[Na+] |
Computed by PubChem (NCBI)