Products 1110656-27-3
CAS 1110656-27-3 is the registry number for 6-[4-(1,1-Dimethylethyl)phenyl]-3-pyridinamine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-(4-tert-butylphenyl)pyridin-3-amine (CAS 1110656-27-3) is a chemical compound with the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. IUPAC name: 6-(4-tert-butylphenyl)pyridin-3-amine. InChIKey: YYWSVTSMIZAJNY-UHFFFAOYSA-N.
| Molecular formula | C15H18N2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | 6-(4-tert-butylphenyl)pyridin-3-amine |
| InChIKey | YYWSVTSMIZAJNY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NC=C(C=C2)N |
Computed by PubChem (NCBI)