CAS 1110717-81-1 appears in our catalog under these names: 2-{2-((2-chloro-4-fluorophenyl)methyl)-1,3-thiazol-4-yl}acetic acid, 95%, 2-{2-((2-Chloro-4-fluorophenyl)methyl)-1,3-thiazol-4-yl}acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-[2-[(2-chloro-4-fluorophenyl)methyl]-1,3-thiazol-4-yl]acetic acid (CAS 1110717-81-1) is a chemical compound with the molecular formula C12H9ClFNO2S and a molecular weight of 285.72 g/mol. IUPAC name: 2-[2-[(2-chloro-4-fluorophenyl)methyl]-1,3-thiazol-4-yl]acetic acid. InChIKey: GAPJSWQEDIJNSZ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFNO2S |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | 2-[2-[(2-chloro-4-fluorophenyl)methyl]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | GAPJSWQEDIJNSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)CC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)