CAS 111088-69-8 appears in our catalog under these names: Olopatadine Impurity 17, (3-Methoxypropyl)triphenylphosphonium bromide, 98%, 98%, (3-METHOXYPROPYL)TRIPHENYLPHOSPHONIUM BROMIDE, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g, 5g, 10g.
3-methoxypropyl(triphenyl)phosphanium bromide (CAS 111088-69-8) is a chemical compound with the molecular formula C22H24BrOP and a molecular weight of 415.3 g/mol. IUPAC name: 3-methoxypropyl(triphenyl)phosphanium bromide. InChIKey: LHNDMMYQNGTXEA-UHFFFAOYSA-M.
| Molecular formula | C22H24BrOP |
|---|---|
| Molecular weight | 415.3 g/mol |
| IUPAC name | 3-methoxypropyl(triphenyl)phosphanium bromide |
| InChIKey | LHNDMMYQNGTXEA-UHFFFAOYSA-M |
| SMILES | COCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)