Products 1110905-26-4
CAS 1110905-26-4 appears in our catalog under these names: MTBT, MTBT, 99.60%, GPOLRXTYEHGQTM-UHFFFAOYSA-N, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 10 mg, 5 mg, 1mg, 50mg, 250mg.
4-[2-(3-methylthiophen-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol (CAS 1110905-26-4) is a chemical compound with the molecular formula C14H11NO2S2 and a molecular weight of 289.4 g/mol. IUPAC name: 4-[2-(3-methylthiophen-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol. InChIKey: GPOLRXTYEHGQTM-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2S2 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | 4-[2-(3-methylthiophen-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol |
| InChIKey | GPOLRXTYEHGQTM-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)C2=NC(=CS2)C3=CC(=C(C=C3)O)O |
Computed by PubChem (NCBI)