Products 1111111-16-0
CAS 1111111-16-0 is the registry number for 2-Hydroxy-6-(2,4,6-trifluorophenyl)pyridine. Offered by: Biosynth. Available pack sizes: 250mg, 100mg.
6-(2,4,6-trifluorophenyl)-1H-pyridin-2-one (CAS 1111111-16-0) is a chemical compound with the molecular formula C11H6F3NO and a molecular weight of 225.17 g/mol. IUPAC name: 6-(2,4,6-trifluorophenyl)-1H-pyridin-2-one. InChIKey: PMWRIMWRYRREDG-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO |
|---|---|
| Molecular weight | 225.17 g/mol |
| IUPAC name | 6-(2,4,6-trifluorophenyl)-1H-pyridin-2-one |
| InChIKey | PMWRIMWRYRREDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC(=C1)C2=C(C=C(C=C2F)F)F |
Computed by PubChem (NCBI)