Products 111112-18-6
CAS 111112-18-6 appears in our catalog under these names: LY195448 HCl, LY-195448 (hydrochloride). Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
4-[3-[[(2R)-2-hydroxy-2-phenylethyl]amino]-3-methylbutyl]benzamide;hydrochloride (CAS 111112-18-6) is a chemical compound with the molecular formula C20H27ClN2O2 and a molecular weight of 362.9 g/mol. IUPAC name: 4-[3-[[(2R)-2-hydroxy-2-phenylethyl]amino]-3-methylbutyl]benzamide;hydrochloride. InChIKey: PFTVHDSGCARRKR-FERBBOLQSA-N.
| Molecular formula | C20H27ClN2O2 |
|---|---|
| Molecular weight | 362.9 g/mol |
| IUPAC name | 4-[3-[[(2R)-2-hydroxy-2-phenylethyl]amino]-3-methylbutyl]benzamide;hydrochloride |
| InChIKey | PFTVHDSGCARRKR-FERBBOLQSA-N |
| SMILES | CC(C)(CCC1=CC=C(C=C1)C(=O)N)NC[C@@H](C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)