Products 1111161-58-0
CAS 1111161-58-0 is the registry number for 3-Acetamido-4-(4-(2-((4-fluorophenyl)amino)-2-oxoethyl)piperazin-1-yl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
3-acetamido-4-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]benzoic acid (CAS 1111161-58-0) is a chemical compound with the molecular formula C21H23FN4O4 and a molecular weight of 414.4 g/mol. IUPAC name: 3-acetamido-4-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]benzoic acid. InChIKey: UPOKDIHTLSMBME-UHFFFAOYSA-N.
| Molecular formula | C21H23FN4O4 |
|---|---|
| Molecular weight | 414.4 g/mol |
| IUPAC name | 3-acetamido-4-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]benzoic acid |
| InChIKey | UPOKDIHTLSMBME-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)C(=O)O)N2CCN(CC2)CC(=O)NC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)