CAS 1111269-34-1 is the registry number for 1-(2-Bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1111269-34-1) is a chemical compound with the molecular formula C11H18BBrN2O2 and a molecular weight of 300.99 g/mol. IUPAC name: 1-(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: TYBUXKMIWBFFJM-UHFFFAOYSA-N.
| Molecular formula | C11H18BBrN2O2 |
|---|---|
| Molecular weight | 300.99 g/mol |
| IUPAC name | 1-(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | TYBUXKMIWBFFJM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CCBr |
Computed by PubChem (NCBI)