CAS 1111300-51-6 is the registry number for CCR9 modulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(4-tert-butylphenyl)sulfonylamino]thiophene-2-carboxylic acid (CAS 1111300-51-6) is a chemical compound with the molecular formula C15H17NO4S2 and a molecular weight of 339.4 g/mol. IUPAC name: 3-[(4-tert-butylphenyl)sulfonylamino]thiophene-2-carboxylic acid. InChIKey: ZQGHKUXYQHDKBP-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4S2 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 3-[(4-tert-butylphenyl)sulfonylamino]thiophene-2-carboxylic acid |
| InChIKey | ZQGHKUXYQHDKBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)NC2=C(SC=C2)C(=O)O |
Computed by PubChem (NCBI)