Products 1111300-51-6

CAS 1111300-51-6 is the registry number for CCR9 modulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

3-[(4-tert-butylphenyl)sulfonylamino]thiophene-2-carboxylic acid (CAS 1111300-51-6) is a chemical compound with the molecular formula C15H17NO4S2 and a molecular weight of 339.4 g/mol. IUPAC name: 3-[(4-tert-butylphenyl)sulfonylamino]thiophene-2-carboxylic acid. InChIKey: ZQGHKUXYQHDKBP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17NO4S2
Molecular weight339.4 g/mol
IUPAC name3-[(4-tert-butylphenyl)sulfonylamino]thiophene-2-carboxylic acid
InChIKeyZQGHKUXYQHDKBP-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC=C(C=C1)S(=O)(=O)NC2=C(SC=C2)C(=O)O

Computed by PubChem (NCBI)