CAS 1111646-44-6 is the registry number for YZK-C22. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-methylthiadiazol-5-yl)-6-(trichloromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (CAS 1111646-44-6) is a chemical compound with the molecular formula C7H3Cl3N6S2 and a molecular weight of 341.6 g/mol. IUPAC name: 3-(4-methylthiadiazol-5-yl)-6-(trichloromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole. InChIKey: CKFAIRWSBXJUBX-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3N6S2 |
|---|---|
| Molecular weight | 341.6 g/mol |
| IUPAC name | 3-(4-methylthiadiazol-5-yl)-6-(trichloromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| InChIKey | CKFAIRWSBXJUBX-UHFFFAOYSA-N |
| SMILES | CC1=C(SN=N1)C2=NN=C3N2N=C(S3)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)