Products 111200-01-2
CAS 111200-01-2 appears in our catalog under these names: 7-Ethoxyrosmanol, min. 95 %, 5 mg, 7–Ethoxyrosmanol, 7-Ethoxyrosmanol, 7-Ethoxyrosmanol, min. 95 %, 10 mg, 7-Ethoxyrosmanol, min. 95 %, 25 mg. Offered by: Roth, GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 1 mg, 5 mg, 20mg.
(1R,8S,9S,10S)-8-ethoxy-3,4-dihydroxy-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-trien-15-one (CAS 111200-01-2) is a chemical compound with the molecular formula C22H30O5 and a molecular weight of 374.5 g/mol. IUPAC name: (1R,8S,9S,10S)-8-ethoxy-3,4-dihydroxy-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-trien-15-one. InChIKey: HEUIVINVBVPWCU-WEMPKCCASA-N.
| Molecular formula | C22H30O5 |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | (1R,8S,9S,10S)-8-ethoxy-3,4-dihydroxy-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-trien-15-one |
| InChIKey | HEUIVINVBVPWCU-WEMPKCCASA-N |
| SMILES | CCO[C@@H]1[C@@H]2[C@@H]3[C@](CCCC3(C)C)(C4=C(C(=C(C=C14)C(C)C)O)O)C(=O)O2 |
Computed by PubChem (NCBI)