CAS 1112126-68-7 is the registry number for Des-(2-cyclohexane-1,3-dione) Fenquinotrione Ethyl Ester. Offered by: TRC. Available pack sizes: 250mg.
Ethyl 8-chloro-4-(4-methoxyphenyl)-3-oxoquinoxaline-2-carboxylate (CAS 1112126-68-7) is a chemical compound with the molecular formula C18H15ClN2O4 and a molecular weight of 358.8 g/mol. IUPAC name: ethyl 8-chloro-4-(4-methoxyphenyl)-3-oxoquinoxaline-2-carboxylate. InChIKey: QNDMDVKTPLLSBY-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O4 |
|---|---|
| Molecular weight | 358.8 g/mol |
| IUPAC name | ethyl 8-chloro-4-(4-methoxyphenyl)-3-oxoquinoxaline-2-carboxylate |
| InChIKey | QNDMDVKTPLLSBY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=CC=C2Cl)N(C1=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)