Products 1112126-68-7

CAS 1112126-68-7 is the registry number for Des-(2-cyclohexane-1,3-dione) Fenquinotrione Ethyl Ester. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

Ethyl 8-chloro-4-(4-methoxyphenyl)-3-oxoquinoxaline-2-carboxylate (CAS 1112126-68-7) is a chemical compound with the molecular formula C18H15ClN2O4 and a molecular weight of 358.8 g/mol. IUPAC name: ethyl 8-chloro-4-(4-methoxyphenyl)-3-oxoquinoxaline-2-carboxylate. InChIKey: QNDMDVKTPLLSBY-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15ClN2O4
Molecular weight358.8 g/mol
IUPAC nameethyl 8-chloro-4-(4-methoxyphenyl)-3-oxoquinoxaline-2-carboxylate
InChIKeyQNDMDVKTPLLSBY-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC2=C(C=CC=C2Cl)N(C1=O)C3=CC=C(C=C3)OC

Computed by PubChem (NCBI)