Products 1112208-70-4
CAS 1112208-70-4 is the registry number for 6-Bromo-1H-pyrido[2,3-d][1,3]oxazine-2,4-dione, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-1H-pyrido[2,3-d][1,3]oxazine-2,4-dione (CAS 1112208-70-4) is a chemical compound with the molecular formula C7H3BrN2O3 and a molecular weight of 243.01 g/mol. IUPAC name: 6-bromo-1H-pyrido[2,3-d][1,3]oxazine-2,4-dione. InChIKey: WTTSMPMDHHCWQZ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrN2O3 |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 6-bromo-1H-pyrido[2,3-d][1,3]oxazine-2,4-dione |
| InChIKey | WTTSMPMDHHCWQZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=O)OC(=O)N2)Br |
Computed by PubChem (NCBI)