CAS 111230-49-0 is the registry number for 3-Chloro-2,4,5-trifluoro-6-nitrobenzoyl Chloride. Offered by: TRC. Available pack sizes: 1g.
3-chloro-2,4,5-trifluoro-6-nitrobenzoyl chloride (CAS 111230-49-0) is a chemical compound with the molecular formula C7Cl2F3NO3 and a molecular weight of 273.98 g/mol. IUPAC name: 3-chloro-2,4,5-trifluoro-6-nitrobenzoyl chloride. InChIKey: VEGPNDIHYYZZMQ-UHFFFAOYSA-N.
| Molecular formula | C7Cl2F3NO3 |
|---|---|
| Molecular weight | 273.98 g/mol |
| IUPAC name | 3-chloro-2,4,5-trifluoro-6-nitrobenzoyl chloride |
| InChIKey | VEGPNDIHYYZZMQ-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)Cl)F)F)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)