CAS 111234-01-6 is the registry number for Lomefloxacin Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-1-ethyl-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid (CAS 111234-01-6) is a chemical compound with the molecular formula C17H19ClFN3O3 and a molecular weight of 367.8 g/mol. IUPAC name: 8-chloro-1-ethyl-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid. InChIKey: FFGTWOOAZSQXPJ-UHFFFAOYSA-N.
| Molecular formula | C17H19ClFN3O3 |
|---|---|
| Molecular weight | 367.8 g/mol |
| IUPAC name | 8-chloro-1-ethyl-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| InChIKey | FFGTWOOAZSQXPJ-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(C(=C21)Cl)N3CCNC(C3)C)F)C(=O)O |
Computed by PubChem (NCBI)