CAS 2483830-12-0 appears in our catalog under these names: Ciprofloxacin–13C3,15N monohydrochloride, Ciprofloxacin-13C3,15N (monohydrochloride), 99.9%, 13C3,15N-Ciprofloxacin hydrochloride, 13C3,15N-Ciprofloxacin hydrochloride, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 1mg, 1 mg, 1x5mg, 1x1ml.
1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;hydrochloride (CAS 2483830-12-0) is a chemical compound with the molecular formula C17H19ClFN3O3 and a molecular weight of 371.77 g/mol. IUPAC name: 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;hydrochloride. InChIKey: DIOIOSKKIYDRIQ-SBKGTBHUSA-N.
| Molecular formula | C17H19ClFN3O3 |
|---|---|
| Molecular weight | 371.77 g/mol |
| IUPAC name | 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;hydrochloride |
| InChIKey | DIOIOSKKIYDRIQ-SBKGTBHUSA-N |
| SMILES | C1CC1[15N]2[13CH]=[13C](C(=O)C3=CC(=C(C=C32)N4CCNCC4)F)[13C](=O)O.Cl |
Computed by PubChem (NCBI)