CAS 111249-01-5 is the registry number for 4-Methyl-1,3-dihydro-2λâ¶,1-benzothiazole-2,2-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-methyl-1,3-dihydro-2,1-benzothiazole 2,2-dioxide (CAS 111249-01-5) is a chemical compound with the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. IUPAC name: 4-methyl-1,3-dihydro-2,1-benzothiazole 2,2-dioxide. InChIKey: MODGSJWQUFMZEM-UHFFFAOYSA-N.
| Molecular formula | C8H9NO2S |
|---|---|
| Molecular weight | 183.23 g/mol |
| IUPAC name | 4-methyl-1,3-dihydro-2,1-benzothiazole 2,2-dioxide |
| InChIKey | MODGSJWQUFMZEM-UHFFFAOYSA-N |
| SMILES | CC1=C2CS(=O)(=O)NC2=CC=C1 |
Computed by PubChem (NCBI)