Products 111337-84-9
CAS 111337-84-9 is the registry number for Sperabillin C. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,5R)-3-amino-N-(3-amino-3-iminopropyl)-6-[[(2E,4E)-hexa-2,4-dienoyl]amino]-5-hydroxyhexanamide (CAS 111337-84-9) is a chemical compound with the molecular formula C15H27N5O3 and a molecular weight of 325.41 g/mol. IUPAC name: (3R,5R)-3-amino-N-(3-amino-3-iminopropyl)-6-[[(2E,4E)-hexa-2,4-dienoyl]amino]-5-hydroxyhexanamide. InChIKey: OAXPQNCOMDEHMJ-IFCBYPGCSA-N.
| Molecular formula | C15H27N5O3 |
|---|---|
| Molecular weight | 325.41 g/mol |
| IUPAC name | (3R,5R)-3-amino-N-(3-amino-3-iminopropyl)-6-[[(2E,4E)-hexa-2,4-dienoyl]amino]-5-hydroxyhexanamide |
| InChIKey | OAXPQNCOMDEHMJ-IFCBYPGCSA-N |
| SMILES | C/C=C/C=C/C(=O)NC[C@@H](C[C@H](CC(=O)NCCC(=N)N)N)O |
Computed by PubChem (NCBI)
Synonyms:
Sperabillin C, orb1701574