CAS 111453-32-8 appears in our catalog under these names: Iohexol Impurity 21, Iopromide Impurity 1, ATH. Offered by: Chemat Brand, HPC Standards. Available pack sizes: on request, 1x5mg.
3-amino-5-(2,3-dihydroxypropylcarbamoyl)-2,4,6-triiodobenzoic acid (CAS 111453-32-8) is a chemical compound with the molecular formula C11H11I3N2O5 and a molecular weight of 631.93 g/mol. IUPAC name: 3-amino-5-(2,3-dihydroxypropylcarbamoyl)-2,4,6-triiodobenzoic acid. InChIKey: URFBLIYCWAORDM-UHFFFAOYSA-N.
| Molecular formula | C11H11I3N2O5 |
|---|---|
| Molecular weight | 631.93 g/mol |
| IUPAC name | 3-amino-5-(2,3-dihydroxypropylcarbamoyl)-2,4,6-triiodobenzoic acid |
| InChIKey | URFBLIYCWAORDM-UHFFFAOYSA-N |
| SMILES | C(C(CO)O)NC(=O)C1=C(C(=C(C(=C1I)N)I)C(=O)O)I |
Computed by PubChem (NCBI)