CAS 1114559-14-6 appears in our catalog under these names: (R)-1-(4-Chloro-3-fluorophenyl)ethanamine, 95%, (R)–1–(4–chloro–3–fluorophenyl)ethan–1–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
(1R)-1-(4-chloro-3-fluorophenyl)ethanamine (CAS 1114559-14-6) is a chemical compound with the molecular formula C8H9ClFN and a molecular weight of 173.61 g/mol. IUPAC name: (1R)-1-(4-chloro-3-fluorophenyl)ethanamine. InChIKey: SRVZZCBLNXFARS-RXMQYKEDSA-N.
| Molecular formula | C8H9ClFN |
|---|---|
| Molecular weight | 173.61 g/mol |
| IUPAC name | (1R)-1-(4-chloro-3-fluorophenyl)ethanamine |
| InChIKey | SRVZZCBLNXFARS-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1)Cl)F)N |
Computed by PubChem (NCBI)