Products 1114621-31-6
CAS 1114621-31-6 is the registry number for P2X7 receptor antagonist-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(1,3-benzodioxol-5-yl)-3-[1,3-bis(4-fluorophenyl)propan-2-yl]urea (CAS 1114621-31-6) is a chemical compound with the molecular formula C23H20F2N2O3 and a molecular weight of 410.4 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-3-[1,3-bis(4-fluorophenyl)propan-2-yl]urea. InChIKey: IAJYHEWTXOMDES-UHFFFAOYSA-N.
| Molecular formula | C23H20F2N2O3 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-3-[1,3-bis(4-fluorophenyl)propan-2-yl]urea |
| InChIKey | IAJYHEWTXOMDES-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC(=O)NC(CC3=CC=C(C=C3)F)CC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)