CAS 111493-51-7 is the registry number for 4-Cyano-1-methyl-1H-pyrazole-5-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-cyano-1-methylpyrazole-5-sulfonamide (CAS 111493-51-7) is a chemical compound with the molecular formula C5H6N4O2S and a molecular weight of 186.19 g/mol. IUPAC name: 4-cyano-1-methylpyrazole-5-sulfonamide. InChIKey: JGZOHDBQDBMFHM-UHFFFAOYSA-N.
| Molecular formula | C5H6N4O2S |
|---|---|
| Molecular weight | 186.19 g/mol |
| IUPAC name | 4-cyano-1-methylpyrazole-5-sulfonamide |
| InChIKey | JGZOHDBQDBMFHM-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C#N)S(=O)(=O)N |
Computed by PubChem (NCBI)