Products 111495-90-0
CAS 111495-90-0 is the registry number for 3′-Azido-2′,3′-dideoxy-5-hydroxyuridine. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg, 10 mg.
1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxypyrimidine-2,4-dione (CAS 111495-90-0) is a chemical compound with the molecular formula C9H11N5O5 and a molecular weight of 269.21 g/mol. IUPAC name: 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxypyrimidine-2,4-dione. InChIKey: AXXNSKSOBHVEGQ-UBKIQSJTSA-N.
| Molecular formula | C9H11N5O5 |
|---|---|
| Molecular weight | 269.21 g/mol |
| IUPAC name | 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxypyrimidine-2,4-dione |
| InChIKey | AXXNSKSOBHVEGQ-UBKIQSJTSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)O)CO)N=[N+]=[N-] |
Computed by PubChem (NCBI)