Products 1115-01-1

CAS 1115-01-1 is the registry number for Methyl 9,10-Dihydroxystearate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 9,10-dihydroxyoctadecanoate (CAS 1115-01-1) is a chemical compound with the molecular formula C19H38O4 and a molecular weight of 330.5 g/mol. IUPAC name: methyl 9,10-dihydroxyoctadecanoate. InChIKey: RITHLQKJQSKUAO-UHFFFAOYSA-N.

Identity
Molecular formulaC19H38O4
Molecular weight330.5 g/mol
IUPAC namemethyl 9,10-dihydroxyoctadecanoate
InChIKeyRITHLQKJQSKUAO-UHFFFAOYSA-N
SMILESCCCCCCCCC(C(CCCCCCCC(=O)OC)O)O

Computed by PubChem (NCBI)