CAS 111544-25-3 is the registry number for 3-amino(1,2,4-triazolyl) 2-nitrophenyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
(3-amino-1,2,4-triazol-1-yl)-(2-nitrophenyl)methanone (CAS 111544-25-3) is a chemical compound with the molecular formula C9H7N5O3 and a molecular weight of 233.18 g/mol. IUPAC name: (3-amino-1,2,4-triazol-1-yl)-(2-nitrophenyl)methanone. InChIKey: LWEBVUNWOXSMMG-UHFFFAOYSA-N.
| Molecular formula | C9H7N5O3 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | (3-amino-1,2,4-triazol-1-yl)-(2-nitrophenyl)methanone |
| InChIKey | LWEBVUNWOXSMMG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)N2C=NC(=N2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)