Products 1115867-62-3
CAS 1115867-62-3 is the registry number for N-hydroxy Rhodamine B amide. Offered by: MedChemExpress. Available pack sizes: Get quote.
3',6'-bis(diethylamino)-2-hydroxyspiro[isoindole-3,9'-xanthene]-1-one (CAS 1115867-62-3) is a chemical compound with the molecular formula C28H31N3O3 and a molecular weight of 457.6 g/mol. IUPAC name: 3',6'-bis(diethylamino)-2-hydroxyspiro[isoindole-3,9'-xanthene]-1-one. InChIKey: UQRQMIDHMQTDCG-UHFFFAOYSA-N.
| Molecular formula | C28H31N3O3 |
|---|---|
| Molecular weight | 457.6 g/mol |
| IUPAC name | 3',6'-bis(diethylamino)-2-hydroxyspiro[isoindole-3,9'-xanthene]-1-one |
| InChIKey | UQRQMIDHMQTDCG-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)N(CC)CC)C5=CC=CC=C5C(=O)N3O |
Computed by PubChem (NCBI)
Synonyms:
N-hydroxy Rhodamine B amide, orb2565682