CAS 111615-20-4 appears in our catalog under these names: Clofarabine Impurity 19, 2-Chloro-9-(2-chloro-2-deoxy-beta-D-arabinofuranosyl)purin-6-amine. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-chloro-2-(hydroxymethyl)oxolan-3-ol (CAS 111615-20-4) is a chemical compound with the molecular formula C10H11Cl2N5O3 and a molecular weight of 320.13 g/mol. IUPAC name: (2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-chloro-2-(hydroxymethyl)oxolan-3-ol. InChIKey: CLIPIWPZUFNPTN-AYQXTPAHSA-N.
| Molecular formula | C10H11Cl2N5O3 |
|---|---|
| Molecular weight | 320.13 g/mol |
| IUPAC name | (2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-chloro-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | CLIPIWPZUFNPTN-AYQXTPAHSA-N |
| SMILES | C1=NC2=C(N=C(N=C2N1[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)Cl)Cl)N |
Computed by PubChem (NCBI)