Products 1116339-61-7
CAS 1116339-61-7 is the registry number for 6-Fluoro-4-(trifluoromethyl)-2-quinolinecarboxamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
6-fluoro-4-(trifluoromethyl)quinoline-2-carboxamide (CAS 1116339-61-7) is a chemical compound with the molecular formula C11H6F4N2O and a molecular weight of 258.17 g/mol. IUPAC name: 6-fluoro-4-(trifluoromethyl)quinoline-2-carboxamide. InChIKey: JMIFMZCJESMKFV-UHFFFAOYSA-N.
| Molecular formula | C11H6F4N2O |
|---|---|
| Molecular weight | 258.17 g/mol |
| IUPAC name | 6-fluoro-4-(trifluoromethyl)quinoline-2-carboxamide |
| InChIKey | JMIFMZCJESMKFV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CC(=N2)C(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)